C25H24O5 — CID 7872158
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(6-methyl-1-benzofuran-3-yl)acetate (PubChem CID 7872158) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(6-methyl-1-benzofuran-3-yl)acetate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(6-methyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7872158 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(6-methyl-1-benzofuran-3-yl)acetate |
| SMILES | Cc1ccc2c(CC(=O)OCc3cc(=O)oc4cc(C)c(C(C)C)cc34)coc2c1 |
| InChI | InChI=1S/C25H24O5/c1-14(2)20-11-21-18(10-25(27)30-23(21)8-16(20)4)13-29-24(26)9-17-12-28-22-7-15(3)5-6-19(17)22/h5-8,10-12,14H,9,13H2,1-4H3 |
| InChIKey | LLGBFYJVMDNBDO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|