C25H26O6 — CID 8534799
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(5-acetyl-2-methoxyphenyl)acetate (PubChem CID 8534799) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(5-acetyl-2-methoxyphenyl)acetate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(5-acetyl-2-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8534799 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(5-acetyl-2-methoxyphenyl)acetate |
| SMILES | COc1ccc(C(C)=O)cc1CC(=O)OCc1cc(=O)oc2cc(C)c(C(C)C)cc12 |
| InChI | InChI=1S/C25H26O6/c1-14(2)20-12-21-19(11-25(28)31-23(21)8-15(20)3)13-30-24(27)10-18-9-17(16(4)26)6-7-22(18)29-5/h6-9,11-12,14H,10,13H2,1-5H3 |
| InChIKey | LZBFAIAILUXJGQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|