C23H22O7 — CID 7902820
(6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(4-acetyl-2-methoxyphenoxy)acetate (PubChem CID 7902820) has the molecular formula C23H22O7 and a molecular weight of 410.42 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(4-acetyl-2-methoxyphenoxy)acetate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(4-acetyl-2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7902820 |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2-(4-acetyl-2-methoxyphenoxy)acetate |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)OCc1cc(=O)oc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C23H22O7/c1-13-7-18-17(10-22(25)30-20(18)8-14(13)2)11-29-23(26)12-28-19-6-5-16(15(3)24)9-21(19)27-4/h5-10H,11-12H2,1-4H3 |
| InChIKey | ZCCHKZSYDHWICX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|