C21H20O6 — CID 7561182
(6,7-dimethyl-2-oxochromen-4-yl)methyl 2,5-dimethoxybenzoate (PubChem CID 7561182) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 2,5-dimethoxybenzoate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7561182 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 2,5-dimethoxybenzoate |
| SMILES | COc1ccc(OC)c(C(=O)OCc2cc(=O)oc3cc(C)c(C)cc23)c1 |
| InChI | InChI=1S/C21H20O6/c1-12-7-16-14(9-20(22)27-19(16)8-13(12)2)11-26-21(23)17-10-15(24-3)5-6-18(17)25-4/h5-10H,11H2,1-4H3 |
| InChIKey | XXQLKCBISLYDSU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|