C21H19NO8 — CID 7235720
(6,7-dimethyl-2-oxochromen-4-yl)methyl 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 7235720) has the molecular formula C21H19NO8 and a molecular weight of 413.38 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 7235720 |
| Molecular Formula | C21H19NO8 |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCc2cc(=O)oc3cc(C)c(C)cc23)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H19NO8/c1-11-5-14-13(7-20(23)30-17(14)6-12(11)2)10-29-21(24)15-8-18(27-3)19(28-4)9-16(15)22(25)26/h5-9H,10H2,1-4H3 |
| InChIKey | OZJQJMKBORJUET-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 118.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|