C17H17NO9 — CID 2400855
methyl 5-[(4,5-dimethoxy-2-nitrobenzoyl)oxymethyl]-2-methylfuran-3-carboxylate (PubChem CID 2400855) has the molecular formula C17H17NO9 and a molecular weight of 379.32 g/mol. Its IUPAC name is methyl 5-[(4,5-dimethoxy-2-nitrobenzoyl)oxymethyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(4,5-dimethoxy-2-nitrobenzoyl)oxymethyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 2400855 |
| Molecular Formula | C17H17NO9 |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | methyl 5-[(4,5-dimethoxy-2-nitrobenzoyl)oxymethyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(COC(=O)c2cc(OC)c(OC)cc2[N+](=O)[O-])oc1C |
| InChI | InChI=1S/C17H17NO9/c1-9-11(16(19)25-4)5-10(27-9)8-26-17(20)12-6-14(23-2)15(24-3)7-13(12)18(21)22/h5-7H,8H2,1-4H3 |
| InChIKey | YNBSOBAMVJRJKI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 127.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|