C14H18N2O8 — CID 2438182
[2-(2-methoxyethylamino)-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 2438182) has the molecular formula C14H18N2O8 and a molecular weight of 342.30 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 2438182 |
| Molecular Formula | C14H18N2O8 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COCCNC(=O)COC(=O)c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N2O8/c1-21-5-4-15-13(17)8-24-14(18)9-6-11(22-2)12(23-3)7-10(9)16(19)20/h6-7H,4-5,8H2,1-3H3,(H,15,17) |
| InChIKey | AFQIZUFTWKLESD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|