C22H26N2O9 — CID 35484004
[2-(3,4-diethoxyanilino)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate (PubChem CID 35484004) has the molecular formula C22H26N2O9 and a molecular weight of 462.46 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 35484004 |
| Molecular Formula | C22H26N2O9 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)OCC(=O)Nc2ccc(OCC)c(OCC)c2)cc1OC |
| InChI | InChI=1S/C22H26N2O9/c1-5-30-17-9-8-14(10-19(17)31-6-2)23-21(25)13-33-22(26)15-11-18(29-4)20(32-7-3)12-16(15)24(27)28/h8-12H,5-7,13H2,1-4H3,(H,23,25) |
| InChIKey | FAXBEVCQQYHZCR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|