C18H17BrN2O7 — CID 55404866
[2-(2-bromoanilino)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate (PubChem CID 55404866) has the molecular formula C18H17BrN2O7 and a molecular weight of 453.25 g/mol. Its IUPAC name is [2-(2-bromoanilino)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate.
| Compound Name | [2-(2-bromoanilino)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 55404866 |
| Molecular Formula | C18H17BrN2O7 |
| Molecular Weight | 453.25 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | [2-(2-bromoanilino)-2-oxoethyl] 4-ethoxy-5-methoxy-2-nitrobenzoate |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)OCC(=O)Nc2ccccc2Br)cc1OC |
| InChI | InChI=1S/C18H17BrN2O7/c1-3-27-16-9-14(21(24)25)11(8-15(16)26-2)18(23)28-10-17(22)20-13-7-5-4-6-12(13)19/h4-9H,3,10H2,1-2H3,(H,20,22) |
| InChIKey | QYXQSWRVQDHINH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|