C21H16F2N2O7 — CID 46675924
[2-(naphthalen-1-ylamino)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate (PubChem CID 46675924) has the molecular formula C21H16F2N2O7 and a molecular weight of 446.36 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 46675924 |
| Molecular Formula | C21H16F2N2O7 |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)Nc2cccc3ccccc23)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C21H16F2N2O7/c1-30-17-9-14(16(25(28)29)10-18(17)32-21(22)23)20(27)31-11-19(26)24-15-8-4-6-12-5-2-3-7-13(12)15/h2-10,21H,11H2,1H3,(H,24,26) |
| InChIKey | DZBKRZDEAHYKQD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|