C19H17F2N3O9 — CID 41407382
[2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate (PubChem CID 41407382) has the molecular formula C19H17F2N3O9 and a molecular weight of 469.35 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate.
| Compound Name | [2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 41407382 |
| Molecular Formula | C19H17F2N3O9 |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | [2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 4-(difluoromethoxy)-5-methoxy-2-nitrobenzoate |
| SMILES | COc1ccc(NC(=O)NC(=O)COC(=O)c2cc(OC)c(OC(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H17F2N3O9/c1-30-11-5-3-10(4-6-11)22-19(27)23-16(25)9-32-17(26)12-7-14(31-2)15(33-18(20)21)8-13(12)24(28)29/h3-8,18H,9H2,1-2H3,(H2,22,23,25,27) |
| InChIKey | AMFMYNUNAQMIJK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|