C16H11F5N2O6 — CID 42158088
4-(difluoromethoxy)-5-methoxy-2-nitro-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 42158088) has the molecular formula C16H11F5N2O6 and a molecular weight of 422.26 g/mol. Its IUPAC name is 4-(difluoromethoxy)-5-methoxy-2-nitro-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-5-methoxy-2-nitro-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 42158088 |
| Molecular Formula | C16H11F5N2O6 |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 4-(difluoromethoxy)-5-methoxy-2-nitro-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(OC(F)(F)F)cc2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C16H11F5N2O6/c1-27-12-6-10(11(23(25)26)7-13(12)28-15(17)18)14(24)22-8-2-4-9(5-3-8)29-16(19,20)21/h2-7,15H,1H3,(H,22,24) |
| InChIKey | QEOLGCHKJLDNHC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|