C22H19F2N3O7 — CID 46672369
4-(difluoromethoxy)-5-methoxy-N'-(2-naphthalen-2-yloxypropanoyl)-2-nitrobenzohydrazide (PubChem CID 46672369) has the molecular formula C22H19F2N3O7 and a molecular weight of 475.40 g/mol. Its IUPAC name is 4-(difluoromethoxy)-5-methoxy-N'-(2-naphthalen-2-yloxypropanoyl)-2-nitrobenzohydrazide.
| Compound Name | 4-(difluoromethoxy)-5-methoxy-N'-(2-naphthalen-2-yloxypropanoyl)-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 46672369 |
| Molecular Formula | C22H19F2N3O7 |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 4-(difluoromethoxy)-5-methoxy-N'-(2-naphthalen-2-yloxypropanoyl)-2-nitrobenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)C(C)Oc2ccc3ccccc3c2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C22H19F2N3O7/c1-12(33-15-8-7-13-5-3-4-6-14(13)9-15)20(28)25-26-21(29)16-10-18(32-2)19(34-22(23)24)11-17(16)27(30)31/h3-12,22H,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | ZTKZXFDMHYLFDU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|