C22H17ClF2N2O5 — CID 46547937
N-[(4-chlorophenyl)-phenylmethyl]-4-(difluoromethoxy)-5-methoxy-2-nitrobenzamide (PubChem CID 46547937) has the molecular formula C22H17ClF2N2O5 and a molecular weight of 462.84 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-phenylmethyl]-4-(difluoromethoxy)-5-methoxy-2-nitrobenzamide.
| Compound Name | N-[(4-chlorophenyl)-phenylmethyl]-4-(difluoromethoxy)-5-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 46547937 |
| Molecular Formula | C22H17ClF2N2O5 |
| Molecular Weight | 462.84 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | N-[(4-chlorophenyl)-phenylmethyl]-4-(difluoromethoxy)-5-methoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NC(c2ccccc2)c2ccc(Cl)cc2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C22H17ClF2N2O5/c1-31-18-11-16(17(27(29)30)12-19(18)32-22(24)25)21(28)26-20(13-5-3-2-4-6-13)14-7-9-15(23)10-8-14/h2-12,20,22H,1H3,(H,26,28) |
| InChIKey | SSDQJKJMRRRXCG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.84 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|