C21H21ClF2N2O7 — CID 24557411
[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate (PubChem CID 24557411) has the molecular formula C21H21ClF2N2O7 and a molecular weight of 486.86 g/mol. Its IUPAC name is [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 24557411 |
| Molecular Formula | C21H21ClF2N2O7 |
| Molecular Weight | 486.86 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl (2S)-2-[(2-chlorobenzoyl)amino]-3-methylbutanoate |
| SMILES | COc1cc(COC(=O)[C@@H](NC(=O)c2ccccc2Cl)C(C)C)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C21H21ClF2N2O7/c1-11(2)18(25-19(27)13-6-4-5-7-14(13)22)20(28)32-10-12-8-16(31-3)17(33-21(23)24)9-15(12)26(29)30/h4-9,11,18,21H,10H2,1-3H3,(H,25,27)/t18-/m0/s1 |
| InChIKey | TZGVSKHDDDEEJM-SFHVURJKSA-N |
| XLogP | 4.36 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.86 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|