C20H22F2N2O8 — CID 55936593
[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate (PubChem CID 55936593) has the molecular formula C20H22F2N2O8 and a molecular weight of 456.40 g/mol. Its IUPAC name is [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate.
| Compound Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55936593 |
| Molecular Formula | C20H22F2N2O8 |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
| SMILES | COc1cc(COC(=O)[C@H](C)N2C(=O)C3CCCCC3C2=O)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C20H22F2N2O8/c1-10(23-17(25)12-5-3-4-6-13(12)18(23)26)19(27)31-9-11-7-15(30-2)16(32-20(21)22)8-14(11)24(28)29/h7-8,10,12-13,20H,3-6,9H2,1-2H3/t10-,12?,13?/m0/s1 |
| InChIKey | NUQRBOOFQGVBPG-PKSQDBQZSA-N |
| XLogP | 2.81 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|