C19H13ClF2N2O6 — CID 55999576
[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 2-chloroquinoline-6-carboxylate (PubChem CID 55999576) has the molecular formula C19H13ClF2N2O6 and a molecular weight of 438.77 g/mol. Its IUPAC name is [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 2-chloroquinoline-6-carboxylate.
| Compound Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55999576 |
| Molecular Formula | C19H13ClF2N2O6 |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 2-chloroquinoline-6-carboxylate |
| SMILES | COc1cc(COC(=O)c2ccc3nc(Cl)ccc3c2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C19H13ClF2N2O6/c1-28-15-7-12(14(24(26)27)8-16(15)30-19(21)22)9-29-18(25)11-2-4-13-10(6-11)3-5-17(20)23-13/h2-8,19H,9H2,1H3 |
| InChIKey | RNQQZJQWYWSCPJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|