C20H18F3NO6 — CID 55538742
[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 1-(4-fluorophenyl)cyclobutane-1-carboxylate (PubChem CID 55538742) has the molecular formula C20H18F3NO6 and a molecular weight of 425.36 g/mol. Its IUPAC name is [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 1-(4-fluorophenyl)cyclobutane-1-carboxylate.
| Compound Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 1-(4-fluorophenyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 55538742 |
| Molecular Formula | C20H18F3NO6 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 1-(4-fluorophenyl)cyclobutane-1-carboxylate |
| SMILES | COc1cc(COC(=O)C2(c3ccc(F)cc3)CCC2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C20H18F3NO6/c1-28-16-9-12(15(24(26)27)10-17(16)30-19(22)23)11-29-18(25)20(7-2-8-20)13-3-5-14(21)6-4-13/h3-6,9-10,19H,2,7-8,11H2,1H3 |
| InChIKey | ILJAMCPEMJDQRC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|