C20H16F2N2O7S — CID 17476378
[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxylate (PubChem CID 17476378) has the molecular formula C20H16F2N2O7S and a molecular weight of 466.42 g/mol. Its IUPAC name is [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxylate.
| Compound Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxylate |
|---|---|
| PubChem CID | 17476378 |
| Molecular Formula | C20H16F2N2O7S |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | [4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl 1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxylate |
| SMILES | COc1cc(COC(=O)C23CCC(=O)N2c2ccccc2S3)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C20H16F2N2O7S/c1-29-14-8-11(13(24(27)28)9-15(14)31-19(21)22)10-30-18(26)20-7-6-17(25)23(20)12-4-2-3-5-16(12)32-20/h2-5,8-9,19H,6-7,10H2,1H3 |
| InChIKey | JQZLUOGCLUYGJD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|