C18H18F2N2O4 — CID 34598561
(2S)-1-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl]-2-methyl-2,3-dihydroindole (PubChem CID 34598561) has the molecular formula C18H18F2N2O4 and a molecular weight of 364.35 g/mol. Its IUPAC name is (2S)-1-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl]-2-methyl-2,3-dihydroindole.
| Compound Name | (2S)-1-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl]-2-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 34598561 |
| Molecular Formula | C18H18F2N2O4 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (2S)-1-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl]-2-methyl-2,3-dihydroindole |
| SMILES | COc1cc(CN2c3ccccc3C[C@@H]2C)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C18H18F2N2O4/c1-11-7-12-5-3-4-6-14(12)21(11)10-13-8-16(25-2)17(26-18(19)20)9-15(13)22(23)24/h3-6,8-9,11,18H,7,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | XQDSPXGWQKEQAC-NSHDSACASA-N |
| XLogP | 4.16 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|