C20H25N3O4 — CID 1376883
1-benzyl-4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazine (PubChem CID 1376883) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-benzyl-4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazine.
| Compound Name | 1-benzyl-4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 1376883 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-benzyl-4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazine |
| SMILES | COc1cc(CN2CCN(Cc3ccccc3)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H25N3O4/c1-26-19-12-17(18(23(24)25)13-20(19)27-2)15-22-10-8-21(9-11-22)14-16-6-4-3-5-7-16/h3-7,12-13H,8-11,14-15H2,1-2H3 |
| InChIKey | GERMEDWQKFHKOX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|