C26H29N3O8 — CID 17367222
1-[(4,5-dimethoxy-2-nitrophenyl)methyl]-4-(naphthalen-1-ylmethyl)piperazine;oxalic acid (PubChem CID 17367222) has the molecular formula C26H29N3O8 and a molecular weight of 511.53 g/mol. Its IUPAC name is 1-[(4,5-dimethoxy-2-nitrophenyl)methyl]-4-(naphthalen-1-ylmethyl)piperazine;oxalic acid.
| Compound Name | 1-[(4,5-dimethoxy-2-nitrophenyl)methyl]-4-(naphthalen-1-ylmethyl)piperazine;oxalic acid |
|---|---|
| PubChem CID | 17367222 |
| Molecular Formula | C26H29N3O8 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 1-[(4,5-dimethoxy-2-nitrophenyl)methyl]-4-(naphthalen-1-ylmethyl)piperazine;oxalic acid |
| SMILES | COc1cc(CN2CCN(Cc3cccc4ccccc34)CC2)c([N+](=O)[O-])cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H27N3O4.C2H2O4/c1-30-23-14-20(22(27(28)29)15-24(23)31-2)17-26-12-10-25(11-13-26)16-19-8-5-7-18-6-3-4-9-21(18)19;3-1(4)2(5)6/h3-9,14-15H,10-13,16-17H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | CGLALHRFSWXMIH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|