C21H24F2N4O5 — CID 31694598
2-[4-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl]piperazin-1-yl]-N-phenylacetamide (PubChem CID 31694598) has the molecular formula C21H24F2N4O5 and a molecular weight of 450.44 g/mol. Its IUPAC name is 2-[4-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl]piperazin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl]piperazin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 31694598 |
| Molecular Formula | C21H24F2N4O5 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 2-[4-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methyl]piperazin-1-yl]-N-phenylacetamide |
| SMILES | COc1cc(CN2CCN(CC(=O)Nc3ccccc3)CC2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C21H24F2N4O5/c1-31-18-11-15(17(27(29)30)12-19(18)32-21(22)23)13-25-7-9-26(10-8-25)14-20(28)24-16-5-3-2-4-6-16/h2-6,11-12,21H,7-10,13-14H2,1H3,(H,24,28) |
| InChIKey | QDVABHWOLSRSOF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|