C18H17F2N3O6 — CID 46418358
N-(2-anilino-2-oxoethyl)-4-(difluoromethoxy)-5-methoxy-N-methyl-2-nitrobenzamide (PubChem CID 46418358) has the molecular formula C18H17F2N3O6 and a molecular weight of 409.35 g/mol. Its IUPAC name is N-(2-anilino-2-oxoethyl)-4-(difluoromethoxy)-5-methoxy-N-methyl-2-nitrobenzamide.
| Compound Name | N-(2-anilino-2-oxoethyl)-4-(difluoromethoxy)-5-methoxy-N-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 46418358 |
| Molecular Formula | C18H17F2N3O6 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N-(2-anilino-2-oxoethyl)-4-(difluoromethoxy)-5-methoxy-N-methyl-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)N(C)CC(=O)Nc2ccccc2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C18H17F2N3O6/c1-22(10-16(24)21-11-6-4-3-5-7-11)17(25)12-8-14(28-2)15(29-18(19)20)9-13(12)23(26)27/h3-9,18H,10H2,1-2H3,(H,21,24) |
| InChIKey | ZDIXKQVCUFBUKD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|