C12H14N2O7 — CID 43234989
2-[(4,5-dimethoxy-2-nitrobenzoyl)-methylamino]acetic acid (PubChem CID 43234989) has the molecular formula C12H14N2O7 and a molecular weight of 298.25 g/mol. Its IUPAC name is 2-[(4,5-dimethoxy-2-nitrobenzoyl)-methylamino]acetic acid.
| Compound Name | 2-[(4,5-dimethoxy-2-nitrobenzoyl)-methylamino]acetic acid |
|---|---|
| PubChem CID | 43234989 |
| Molecular Formula | C12H14N2O7 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-[(4,5-dimethoxy-2-nitrobenzoyl)-methylamino]acetic acid |
| SMILES | COc1cc(C(=O)N(C)CC(=O)O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C12H14N2O7/c1-13(6-11(15)16)12(17)7-4-9(20-2)10(21-3)5-8(7)14(18)19/h4-5H,6H2,1-3H3,(H,15,16) |
| InChIKey | YZXKTXLHBCOCBZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|