C12H16N2O5 — CID 170896249
1-(4,5-dimethoxy-2-nitrophenyl)-2-(dimethylamino)ethanone (PubChem CID 170896249) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-nitrophenyl)-2-(dimethylamino)ethanone.
| Compound Name | 1-(4,5-dimethoxy-2-nitrophenyl)-2-(dimethylamino)ethanone |
|---|---|
| PubChem CID | 170896249 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-(4,5-dimethoxy-2-nitrophenyl)-2-(dimethylamino)ethanone |
| SMILES | COc1cc(C(=O)CN(C)C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C12H16N2O5/c1-13(2)7-10(15)8-5-11(18-3)12(19-4)6-9(8)14(16)17/h5-6H,7H2,1-4H3 |
| InChIKey | PNGHBQXIXUZUPM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|