C16H21NO5 — CID 12630327
2-cyclohexyl-1-(4,5-dimethoxy-2-nitrophenyl)ethanone (PubChem CID 12630327) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-cyclohexyl-1-(4,5-dimethoxy-2-nitrophenyl)ethanone.
| Compound Name | 2-cyclohexyl-1-(4,5-dimethoxy-2-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 12630327 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-cyclohexyl-1-(4,5-dimethoxy-2-nitrophenyl)ethanone |
| SMILES | COc1cc(C(=O)CC2CCCCC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H21NO5/c1-21-15-9-12(13(17(19)20)10-16(15)22-2)14(18)8-11-6-4-3-5-7-11/h9-11H,3-8H2,1-2H3 |
| InChIKey | KDZUBTJKHVXMKV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|