C10H13ClN2O5 — CID 117068513
2-amino-1-(4,5-dimethoxy-2-nitrophenyl)ethanone;hydrochloride (PubChem CID 117068513) has the molecular formula C10H13ClN2O5 and a molecular weight of 276.68 g/mol. Its IUPAC name is 2-amino-1-(4,5-dimethoxy-2-nitrophenyl)ethanone;hydrochloride.
| Compound Name | 2-amino-1-(4,5-dimethoxy-2-nitrophenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 117068513 |
| Molecular Formula | C10H13ClN2O5 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-amino-1-(4,5-dimethoxy-2-nitrophenyl)ethanone;hydrochloride |
| SMILES | COc1cc(C(=O)CN)c([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C10H12N2O5.ClH/c1-16-9-3-6(8(13)5-11)7(12(14)15)4-10(9)17-2;/h3-4H,5,11H2,1-2H3;1H |
| InChIKey | SSCKUUQMFBKXLN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|