C13H15NO8 — CID 175208257
4,5-dimethoxy-2-nitrobenzoic acid;2-methylprop-2-enoic acid (PubChem CID 175208257) has the molecular formula C13H15NO8 and a molecular weight of 313.26 g/mol. Its IUPAC name is 4,5-dimethoxy-2-nitrobenzoic acid;2-methylprop-2-enoic acid.
| Compound Name | 4,5-dimethoxy-2-nitrobenzoic acid;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 175208257 |
| Molecular Formula | C13H15NO8 |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 4,5-dimethoxy-2-nitrobenzoic acid;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.COc1cc(C(=O)O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C9H9NO6.C4H6O2/c1-15-7-3-5(9(11)12)6(10(13)14)4-8(7)16-2;1-3(2)4(5)6/h3-4H,1-2H3,(H,11,12);1H2,2H3,(H,5,6) |
| InChIKey | LDRMHUMHNZMNPF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|