C12H10N2O6S — CID 43311669
5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)benzoic acid (PubChem CID 43311669) has the molecular formula C12H10N2O6S and a molecular weight of 310.29 g/mol. Its IUPAC name is 5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)benzoic acid.
| Compound Name | 5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 43311669 |
| Molecular Formula | C12H10N2O6S |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)benzoic acid |
| SMILES | COc1cc(C(=O)O)c([N+](=O)[O-])cc1OCc1cscn1 |
| InChI | InChI=1S/C12H10N2O6S/c1-19-10-2-8(12(15)16)9(14(17)18)3-11(10)20-4-7-5-21-6-13-7/h2-3,5-6H,4H2,1H3,(H,15,16) |
| InChIKey | QCGWJDCBTNENHU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|