C17H22Cl2N4O5S — CID 119417426
1,4-diazepan-1-yl-[5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)phenyl]methanone;dihydrochloride (PubChem CID 119417426) has the molecular formula C17H22Cl2N4O5S and a molecular weight of 465.36 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-[5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)phenyl]methanone;dihydrochloride.
| Compound Name | 1,4-diazepan-1-yl-[5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)phenyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119417426 |
| Molecular Formula | C17H22Cl2N4O5S |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 1,4-diazepan-1-yl-[5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)phenyl]methanone;dihydrochloride |
| SMILES | COc1cc(C(=O)N2CCCNCC2)c([N+](=O)[O-])cc1OCc1cscn1.Cl.Cl |
| InChI | InChI=1S/C17H20N4O5S.2ClH/c1-25-15-7-13(17(22)20-5-2-3-18-4-6-20)14(21(23)24)8-16(15)26-9-12-10-27-11-19-12;;/h7-8,10-11,18H,2-6,9H2,1H3;2*1H |
| InChIKey | QIKXHTPURFMNDV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|