C17H19N3O5S — CID 51125348
[5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)phenyl]-piperidin-1-ylmethanone (PubChem CID 51125348) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is [5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)phenyl]-piperidin-1-ylmethanone.
| Compound Name | [5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 51125348 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)phenyl]-piperidin-1-ylmethanone |
| SMILES | COc1cc(C(=O)N2CCCCC2)c([N+](=O)[O-])cc1OCc1cscn1 |
| InChI | InChI=1S/C17H19N3O5S/c1-24-15-7-13(17(21)19-5-3-2-4-6-19)14(20(22)23)8-16(15)25-9-12-10-26-11-18-12/h7-8,10-11H,2-6,9H2,1H3 |
| InChIKey | MHMOBZBQZDYMNY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|