C21H29N3O6 — CID 31610743
azepan-1-yl-[1-(4,5-dimethoxy-2-nitrobenzoyl)piperidin-4-yl]methanone (PubChem CID 31610743) has the molecular formula C21H29N3O6 and a molecular weight of 419.48 g/mol. Its IUPAC name is azepan-1-yl-[1-(4,5-dimethoxy-2-nitrobenzoyl)piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-(4,5-dimethoxy-2-nitrobenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 31610743 |
| Molecular Formula | C21H29N3O6 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | azepan-1-yl-[1-(4,5-dimethoxy-2-nitrobenzoyl)piperidin-4-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCC(C(=O)N3CCCCCC3)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H29N3O6/c1-29-18-13-16(17(24(27)28)14-19(18)30-2)21(26)23-11-7-15(8-12-23)20(25)22-9-5-3-4-6-10-22/h13-15H,3-12H2,1-2H3 |
| InChIKey | PVVDVFOHTAIROJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|