C15H22ClN3O5 — CID 119592495
(4-amino-3-methylpiperidin-1-yl)-(4,5-dimethoxy-2-nitrophenyl)methanone;hydrochloride (PubChem CID 119592495) has the molecular formula C15H22ClN3O5 and a molecular weight of 359.81 g/mol. Its IUPAC name is (4-amino-3-methylpiperidin-1-yl)-(4,5-dimethoxy-2-nitrophenyl)methanone;hydrochloride.
| Compound Name | (4-amino-3-methylpiperidin-1-yl)-(4,5-dimethoxy-2-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119592495 |
| Molecular Formula | C15H22ClN3O5 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (4-amino-3-methylpiperidin-1-yl)-(4,5-dimethoxy-2-nitrophenyl)methanone;hydrochloride |
| SMILES | COc1cc(C(=O)N2CCC(N)C(C)C2)c([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C15H21N3O5.ClH/c1-9-8-17(5-4-11(9)16)15(19)10-6-13(22-2)14(23-3)7-12(10)18(20)21;/h6-7,9,11H,4-5,8,16H2,1-3H3;1H |
| InChIKey | NMJGZPHKZIGSLZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|