C15H22N2O3 — CID 79880599
(4-amino-3-methylpiperidin-1-yl)-(2,5-dimethoxyphenyl)methanone (PubChem CID 79880599) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is (4-amino-3-methylpiperidin-1-yl)-(2,5-dimethoxyphenyl)methanone.
| Compound Name | (4-amino-3-methylpiperidin-1-yl)-(2,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 79880599 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (4-amino-3-methylpiperidin-1-yl)-(2,5-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(OC)c(C(=O)N2CCC(N)C(C)C2)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-10-9-17(7-6-13(10)16)15(18)12-8-11(19-2)4-5-14(12)20-3/h4-5,8,10,13H,6-7,9,16H2,1-3H3 |
| InChIKey | KZEKNVUHCSCNGX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |