1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid

C15H19NO5 — CID 43092130

IUPAC1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid
SMILESCOc1ccc(OC)c(C(=O)N2CCCC(C(=O)O)C2)c1
InChIInChI=1S/C15H19NO5/c1-20-11-5-6-13(21-2)12(8-11)14(17)16-7-3-4-10(9-16)15(18)19/h5-6,8,10H,3-4,7,9H2,1-2H3,(H,18,19)
InChIKeyHZRHKFIZNORLGE-UHFFFAOYSA-N
MW293.32 g/mol
LogP1.64
Rot. Bonds4

About 1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid

1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid (PubChem CID 43092130) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid
PubChem CID43092130
Molecular FormulaC15H19NO5
Molecular Weight293.32 g/mol
Exact Mass293.13
IUPAC Name1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid
SMILESCOc1ccc(OC)c(C(=O)N2CCCC(C(=O)O)C2)c1
InChIInChI=1S/C15H19NO5/c1-20-11-5-6-13(21-2)12(8-11)14(17)16-7-3-4-10(9-16)15(18)19/h5-6,8,10H,3-4,7,9H2,1-2H3,(H,18,19)
InChIKeyHZRHKFIZNORLGE-UHFFFAOYSA-N
XLogP1.64
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.32
LogP ≤ 51.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid?
The IUPAC name of 1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid (CID 43092130) is 1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid.
What is the SMILES notation for 1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid?
The canonical SMILES for 1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid is COc1ccc(OC)c(C(=O)N2CCCC(C(=O)O)C2)c1.
What is the InChIKey of 1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid?
The InChIKey is HZRHKFIZNORLGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO5/c1-20-11-5-6-13(21-2)12(8-11)14(17)16-7-3-4-10(9-16)15(18)19/h5-6,8,10H,3-4,7,9H2,1-2H3,(H,18,19).
What are the key properties of 1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid?
1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid has a molecular weight of 293.32 g/mol, XLogP of 1.64, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 43092130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).