C16H21NO6 — CID 119113565
(3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid (PubChem CID 119113565) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is (3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119113565 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc(C(=O)N2CCC[C@H](C(=O)O)C2)c(OC)c1OC |
| InChI | InChI=1S/C16H21NO6/c1-21-12-7-6-11(13(22-2)14(12)23-3)15(18)17-8-4-5-10(9-17)16(19)20/h6-7,10H,4-5,8-9H2,1-3H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | GVFHYTZWUCMXPS-JTQLQIEISA-N |
| XLogP | 1.65 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |