(3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid

C16H21NO6 — CID 119113565

IUPAC(3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid
SMILESCOc1ccc(C(=O)N2CCC[C@H](C(=O)O)C2)c(OC)c1OC
InChIInChI=1S/C16H21NO6/c1-21-12-7-6-11(13(22-2)14(12)23-3)15(18)17-8-4-5-10(9-17)16(19)20/h6-7,10H,4-5,8-9H2,1-3H3,(H,19,20)/t10-/m0/s1
InChIKeyGVFHYTZWUCMXPS-JTQLQIEISA-N
MW323.35 g/mol
LogP1.65
Rot. Bonds5

About (3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid

(3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid (PubChem CID 119113565) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is (3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid.

Molecular Properties

Compound Name(3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid
PubChem CID119113565
Molecular FormulaC16H21NO6
Molecular Weight323.35 g/mol
Exact Mass323.14
IUPAC Name(3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid
SMILESCOc1ccc(C(=O)N2CCC[C@H](C(=O)O)C2)c(OC)c1OC
InChIInChI=1S/C16H21NO6/c1-21-12-7-6-11(13(22-2)14(12)23-3)15(18)17-8-4-5-10(9-17)16(19)20/h6-7,10H,4-5,8-9H2,1-3H3,(H,19,20)/t10-/m0/s1
InChIKeyGVFHYTZWUCMXPS-JTQLQIEISA-N
XLogP1.65
TPSA85.30 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500323.35
LogP ≤ 51.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze (3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid?
The IUPAC name of (3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid (CID 119113565) is (3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid.
What is the SMILES notation for (3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid?
The canonical SMILES for (3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid is COc1ccc(C(=O)N2CCC[C@H](C(=O)O)C2)c(OC)c1OC.
What is the InChIKey of (3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid?
The InChIKey is GVFHYTZWUCMXPS-JTQLQIEISA-N. The full InChI is InChI=1S/C16H21NO6/c1-21-12-7-6-11(13(22-2)14(12)23-3)15(18)17-8-4-5-10(9-17)16(19)20/h6-7,10H,4-5,8-9H2,1-3H3,(H,19,20)/t10-/m0/s1.
What are the key properties of (3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid?
(3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid has a molecular weight of 323.35 g/mol, XLogP of 1.65, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(2,3,4-trimethoxybenzoyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 119113565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).