C17H25NO4 — CID 78771101
azocan-1-yl-(2,3,4-trimethoxyphenyl)methanone (PubChem CID 78771101) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is azocan-1-yl-(2,3,4-trimethoxyphenyl)methanone.
| Compound Name | azocan-1-yl-(2,3,4-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 78771101 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | azocan-1-yl-(2,3,4-trimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCCCCCC2)c(OC)c1OC |
| InChI | InChI=1S/C17H25NO4/c1-20-14-10-9-13(15(21-2)16(14)22-3)17(19)18-11-7-5-4-6-8-12-18/h9-10H,4-8,11-12H2,1-3H3 |
| InChIKey | CKFUEAHNSFCCKP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |