C17H22N2O5 — CID 126814847
1-[4-(2,3,4-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 126814847) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 1-[4-(2,3,4-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-(2,3,4-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 126814847 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[4-(2,3,4-trimethoxybenzoyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C(=O)c2ccc(OC)c(OC)c2OC)CC1 |
| InChI | InChI=1S/C17H22N2O5/c1-5-14(20)18-8-10-19(11-9-18)17(21)12-6-7-13(22-2)16(24-4)15(12)23-3/h5-7H,1,8-11H2,2-4H3 |
| InChIKey | JIXTZILBWDPDJP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|