C23H29N3O5 — CID 27854744
N-(4-methylphenyl)-2-[4-(2,3,4-trimethoxybenzoyl)piperazin-1-yl]acetamide (PubChem CID 27854744) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[4-(2,3,4-trimethoxybenzoyl)piperazin-1-yl]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[4-(2,3,4-trimethoxybenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 27854744 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | N-(4-methylphenyl)-2-[4-(2,3,4-trimethoxybenzoyl)piperazin-1-yl]acetamide |
| SMILES | COc1ccc(C(=O)N2CCN(CC(=O)Nc3ccc(C)cc3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C23H29N3O5/c1-16-5-7-17(8-6-16)24-20(27)15-25-11-13-26(14-12-25)23(28)18-9-10-19(29-2)22(31-4)21(18)30-3/h5-10H,11-15H2,1-4H3,(H,24,27) |
| InChIKey | OZTKEFJKMCKQTA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |