C21H21F3N4O6 — CID 46654951
2-[4-(2-methoxy-5-nitrobenzoyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 46654951) has the molecular formula C21H21F3N4O6 and a molecular weight of 482.42 g/mol. Its IUPAC name is 2-[4-(2-methoxy-5-nitrobenzoyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[4-(2-methoxy-5-nitrobenzoyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 46654951 |
| Molecular Formula | C21H21F3N4O6 |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-[4-(2-methoxy-5-nitrobenzoyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)N1CCN(CC(=O)Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H21F3N4O6/c1-33-18-7-4-15(28(31)32)12-17(18)20(30)27-10-8-26(9-11-27)13-19(29)25-14-2-5-16(6-3-14)34-21(22,23)24/h2-7,12H,8-11,13H2,1H3,(H,25,29) |
| InChIKey | UJFLKOBBQSHANI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|