C20H20F3N3O4 — CID 43017485
2-[4-(2-hydroxybenzoyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 43017485) has the molecular formula C20H20F3N3O4 and a molecular weight of 423.39 g/mol. Its IUPAC name is 2-[4-(2-hydroxybenzoyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[4-(2-hydroxybenzoyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 43017485 |
| Molecular Formula | C20H20F3N3O4 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 2-[4-(2-hydroxybenzoyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2ccccc2O)CC1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3N3O4/c21-20(22,23)30-15-7-5-14(6-8-15)24-18(28)13-25-9-11-26(12-10-25)19(29)16-3-1-2-4-17(16)27/h1-8,27H,9-13H2,(H,24,28) |
| InChIKey | KGYXYPRJZHRIKF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |