C15H22N2O4 — CID 43635827
(4-aminopiperidin-1-yl)-(2,3,4-trimethoxyphenyl)methanone (PubChem CID 43635827) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-(2,3,4-trimethoxyphenyl)methanone.
| Compound Name | (4-aminopiperidin-1-yl)-(2,3,4-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 43635827 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (4-aminopiperidin-1-yl)-(2,3,4-trimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCC(N)CC2)c(OC)c1OC |
| InChI | InChI=1S/C15H22N2O4/c1-19-12-5-4-11(13(20-2)14(12)21-3)15(18)17-8-6-10(16)7-9-17/h4-5,10H,6-9,16H2,1-3H3 |
| InChIKey | LZFFDEAOQJLTDA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |