C19H29N3O5 — CID 119816831
4-(methylamino)-1-[4-(2,3,4-trimethoxybenzoyl)piperazin-1-yl]butan-1-one (PubChem CID 119816831) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-(methylamino)-1-[4-(2,3,4-trimethoxybenzoyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(methylamino)-1-[4-(2,3,4-trimethoxybenzoyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 119816831 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 4-(methylamino)-1-[4-(2,3,4-trimethoxybenzoyl)piperazin-1-yl]butan-1-one |
| SMILES | CNCCCC(=O)N1CCN(C(=O)c2ccc(OC)c(OC)c2OC)CC1 |
| InChI | InChI=1S/C19H29N3O5/c1-20-9-5-6-16(23)21-10-12-22(13-11-21)19(24)14-7-8-15(25-2)18(27-4)17(14)26-3/h7-8,20H,5-6,9-13H2,1-4H3 |
| InChIKey | KCRKAWZLOKSUSP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|