C23H28N2O4 — CID 108533625
1-[4-(2-methoxybenzoyl)piperazin-1-yl]-4-(4-methylphenoxy)butan-1-one (PubChem CID 108533625) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-[4-(2-methoxybenzoyl)piperazin-1-yl]-4-(4-methylphenoxy)butan-1-one.
| Compound Name | 1-[4-(2-methoxybenzoyl)piperazin-1-yl]-4-(4-methylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 108533625 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-[4-(2-methoxybenzoyl)piperazin-1-yl]-4-(4-methylphenoxy)butan-1-one |
| SMILES | COc1ccccc1C(=O)N1CCN(C(=O)CCCOc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C23H28N2O4/c1-18-9-11-19(12-10-18)29-17-5-8-22(26)24-13-15-25(16-14-24)23(27)20-6-3-4-7-21(20)28-2/h3-4,6-7,9-12H,5,8,13-17H2,1-2H3 |
| InChIKey | ZTPXTEHLURKHBO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|