C24H25N3O5 — CID 108533634
2-[4-[4-(2-methoxybenzoyl)piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione (PubChem CID 108533634) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is 2-[4-[4-(2-methoxybenzoyl)piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-(2-methoxybenzoyl)piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108533634 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-[4-[4-(2-methoxybenzoyl)piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione |
| SMILES | COc1ccccc1C(=O)N1CCN(C(=O)CCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C24H25N3O5/c1-32-20-10-5-4-9-19(20)22(29)26-15-13-25(14-16-26)21(28)11-6-12-27-23(30)17-7-2-3-8-18(17)24(27)31/h2-5,7-10H,6,11-16H2,1H3 |
| InChIKey | JMZOFZOHDIJCMO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|