C27H25N3O5 — CID 55646044
2-[4-[4-(2-hydroxybenzoyl)piperazin-1-yl]-4-oxobutyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 55646044) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is 2-[4-[4-(2-hydroxybenzoyl)piperazin-1-yl]-4-oxobutyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[4-[4-(2-hydroxybenzoyl)piperazin-1-yl]-4-oxobutyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 55646044 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 2-[4-[4-(2-hydroxybenzoyl)piperazin-1-yl]-4-oxobutyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C(CCCN1C(=O)c2cccc3cccc(c23)C1=O)N1CCN(C(=O)c2ccccc2O)CC1 |
| InChI | InChI=1S/C27H25N3O5/c31-22-11-2-1-8-19(22)25(33)29-16-14-28(15-17-29)23(32)12-5-13-30-26(34)20-9-3-6-18-7-4-10-21(24(18)20)27(30)35/h1-4,6-11,31H,5,12-17H2 |
| InChIKey | ABPXHKNLZFBQPU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|