C22H21F3N2O3 — CID 27445775
2-[4-oxo-4-[(3S)-3-(trifluoromethyl)piperidin-1-yl]butyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 27445775) has the molecular formula C22H21F3N2O3 and a molecular weight of 418.42 g/mol. Its IUPAC name is 2-[4-oxo-4-[(3S)-3-(trifluoromethyl)piperidin-1-yl]butyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[4-oxo-4-[(3S)-3-(trifluoromethyl)piperidin-1-yl]butyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 27445775 |
| Molecular Formula | C22H21F3N2O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-[4-oxo-4-[(3S)-3-(trifluoromethyl)piperidin-1-yl]butyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C(CCCN1C(=O)c2cccc3cccc(c23)C1=O)N1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C22H21F3N2O3/c23-22(24,25)15-7-3-11-26(13-15)18(28)10-4-12-27-20(29)16-8-1-5-14-6-2-9-17(19(14)16)21(27)30/h1-2,5-6,8-9,15H,3-4,7,10-13H2/t15-/m0/s1 |
| InChIKey | QIJSCSSTSQBSSL-HNNXBMFYSA-N |
| XLogP | 4.02 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|