C17H16F3NO — CID 51556451
naphthalen-1-yl-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 51556451) has the molecular formula C17H16F3NO and a molecular weight of 307.31 g/mol. Its IUPAC name is naphthalen-1-yl-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | naphthalen-1-yl-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 51556451 |
| Molecular Formula | C17H16F3NO |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | naphthalen-1-yl-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cccc2ccccc12)N1CCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C17H16F3NO/c18-17(19,20)13-7-4-10-21(11-13)16(22)15-9-3-6-12-5-1-2-8-14(12)15/h1-3,5-6,8-9,13H,4,7,10-11H2/t13-/m1/s1 |
| InChIKey | GKIKDDLWVZLADF-CYBMUJFWSA-N |
| XLogP | 4.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |