C23H21NO3 — CID 95728859
[(3R)-1-(2-hydroxybenzoyl)piperidin-3-yl]-naphthalen-1-ylmethanone (PubChem CID 95728859) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is [(3R)-1-(2-hydroxybenzoyl)piperidin-3-yl]-naphthalen-1-ylmethanone.
| Compound Name | [(3R)-1-(2-hydroxybenzoyl)piperidin-3-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 95728859 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | [(3R)-1-(2-hydroxybenzoyl)piperidin-3-yl]-naphthalen-1-ylmethanone |
| SMILES | O=C(c1cccc2ccccc12)[C@@H]1CCCN(C(=O)c2ccccc2O)C1 |
| InChI | InChI=1S/C23H21NO3/c25-21-13-4-3-11-20(21)23(27)24-14-6-9-17(15-24)22(26)19-12-5-8-16-7-1-2-10-18(16)19/h1-5,7-8,10-13,17,25H,6,9,14-15H2/t17-/m1/s1 |
| InChIKey | SSNNBJGAXBPSID-QGZVFWFLSA-N |
| XLogP | 4.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |